CAS 872362-65-7 is the registry number for 2,5-Dichloro-N'-hydroxybenzene-1-carboximidamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,5-dichloro-N'-hydroxybenzenecarboximidamide (CAS 872362-65-7) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: 2,5-dichloro-N'-hydroxybenzenecarboximidamide. InChIKey: GWKVXKWWONLJLZ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 2,5-dichloro-N'-hydroxybenzenecarboximidamide |
| InChIKey | GWKVXKWWONLJLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=NO)N)Cl |
Computed by PubChem (NCBI)