Products 872785-39-2
CAS 872785-39-2 is the registry number for 1-Benzyl-2,3-dihydro-1-indene-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzyl-2,3-dihydroindene-1-carboxylic acid (CAS 872785-39-2) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 1-benzyl-2,3-dihydroindene-1-carboxylic acid. InChIKey: DVUFWAJSVZUQTP-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1-benzyl-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | DVUFWAJSVZUQTP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)