CAS 874889-34-6 appears in our catalog under these names: 3,5-Difluoro-N-methoxy-N-methylbenzamide, 97%, 3,5-Difluoro-N-methoxy-N-methylbenzamide, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 500mg, 1g, 5g.
3,5-difluoro-N-methoxy-N-methylbenzamide (CAS 874889-34-6) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 3,5-difluoro-N-methoxy-N-methylbenzamide. InChIKey: NAGFTAKIGZFDQR-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 3,5-difluoro-N-methoxy-N-methylbenzamide |
| InChIKey | NAGFTAKIGZFDQR-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=CC(=C1)F)F)OC |
Computed by PubChem (NCBI)