CAS 875446-29-0 appears in our catalog under these names: (4–Fluoro–5–isopropyl–2–methoxyphenyl)boronic acid, 4-Fluoro-5-isopropyl-2-methoxyphenylboronic Acid (contains varying amounts of Anhydride), (4-Fluoro-5-isopropyl-2-methoxyphenyl)boronic acid, 98%, 98%, 4-Fluoro-5-isopropyl-2-methoxyphenylboronic acid, 99.47%, (4-Fluoro-5-isopropyl-2-methoxyphenyl)boronic acid, 98%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 250 mg, 25 g, 1 g.
(4-fluoro-2-methoxy-5-propan-2-ylphenyl)boronic acid (CAS 875446-29-0) is a chemical compound with the molecular formula C10H14BFO3 and a molecular weight of 212.03 g/mol. IUPAC name: (4-fluoro-2-methoxy-5-propan-2-ylphenyl)boronic acid. InChIKey: HMRRCUXJGOSJJA-UHFFFAOYSA-N.
| Molecular formula | C10H14BFO3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | (4-fluoro-2-methoxy-5-propan-2-ylphenyl)boronic acid |
| InChIKey | HMRRCUXJGOSJJA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)F)C(C)C)(O)O |
Computed by PubChem (NCBI)