Products 875467-74-6
CAS 875467-74-6 is the registry number for (1R)-2-Amino-1-(4-chlorophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-2-amino-1-(4-chlorophenyl)ethanol;hydrochloride (CAS 875467-74-6) is a chemical compound with the molecular formula C8H11Cl2NO and a molecular weight of 208.08 g/mol. IUPAC name: (1R)-2-amino-1-(4-chlorophenyl)ethanol;hydrochloride. InChIKey: UZMQBTSMAZWEOT-QRPNPIFTSA-N.
| Molecular formula | C8H11Cl2NO |
|---|---|
| Molecular weight | 208.08 g/mol |
| IUPAC name | (1R)-2-amino-1-(4-chlorophenyl)ethanol;hydrochloride |
| InChIKey | UZMQBTSMAZWEOT-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CN)O)Cl.Cl |
Computed by PubChem (NCBI)