Products 876189-19-4
CAS 876189-19-4 appears in our catalog under these names: 4-Methoxycarbonyl-3,5-dimethylphenylboronic acid, 97%, (4-(Methoxycarbonyl)-3,5-dimethylphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-methoxycarbonyl-3,5-dimethylphenyl)boronic acid (CAS 876189-19-4) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (4-methoxycarbonyl-3,5-dimethylphenyl)boronic acid. InChIKey: PZRQLKHCAJPJDQ-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (4-methoxycarbonyl-3,5-dimethylphenyl)boronic acid |
| InChIKey | PZRQLKHCAJPJDQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C(=O)OC)C)(O)O |
Computed by PubChem (NCBI)