Products 876343-38-3
CAS 876343-38-3 appears in our catalog under these names: 5-Nitroisoindolin-1-one, 98%, 5-Nitroisoindolin-1-one, 5-Nitroisoindolin-1-one 98%, 5-Nitroisoindolin-1-one, 98%, 98%, 5-Nitroisoindolin-1-one, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 100mg.
5-nitro-2,3-dihydroisoindol-1-one (CAS 876343-38-3) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-nitro-2,3-dihydroisoindol-1-one. InChIKey: CZXUANYPXDFFOG-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | CZXUANYPXDFFOG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)