CAS 87657-67-8 is the registry number for TRPV1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(3,4-dihydroxyphenyl)-7-phenylhept-1-en-3-one (CAS 87657-67-8) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: (E)-1-(3,4-dihydroxyphenyl)-7-phenylhept-1-en-3-one. InChIKey: LPXLSRPTQKGMGD-ZRDIBKRKSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (E)-1-(3,4-dihydroxyphenyl)-7-phenylhept-1-en-3-one |
| InChIKey | LPXLSRPTQKGMGD-ZRDIBKRKSA-N |
| SMILES | C1=CC=C(C=C1)CCCCC(=O)/C=C/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)