CAS 87666-62-4 is the registry number for [1,1':2',1''-Terphenyl]-3'-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-diphenylaniline (CAS 87666-62-4) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2,3-diphenylaniline. InChIKey: IVTDTSPPDZBCHD-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2,3-diphenylaniline |
| InChIKey | IVTDTSPPDZBCHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)