Products 875228-76-5

CAS 875228-76-5 is the registry number for 3-Methyl-2,4-diphenylpyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-methyl-2,4-diphenylpyridine (CAS 875228-76-5) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 3-methyl-2,4-diphenylpyridine. InChIKey: LUJPBPCJOCDMAP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15N
Molecular weight245.3 g/mol
IUPAC name3-methyl-2,4-diphenylpyridine
InChIKeyLUJPBPCJOCDMAP-UHFFFAOYSA-N
SMILESCC1=C(C=CN=C1C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)