CAS 87666-57-7 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-2'-amine, 95%, [1,1':3',1''-Terphenyl]-2'-amine 95%, [1,1':3',1''-Terphenyl]-2'-amine, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100g, 10g, 25g.
2,6-diphenylaniline (CAS 87666-57-7) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2,6-diphenylaniline. InChIKey: DSQMLISBVUTWJB-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2,6-diphenylaniline |
| InChIKey | DSQMLISBVUTWJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)