CAS 102027-97-4 is the registry number for 5-(Anthracen-9-yl)-3,4-dihydro-2H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-anthracen-9-yl-3,4-dihydro-2H-pyrrole (CAS 102027-97-4) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 5-anthracen-9-yl-3,4-dihydro-2H-pyrrole. InChIKey: FEAMNHISNWMBOV-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 5-anthracen-9-yl-3,4-dihydro-2H-pyrrole |
| InChIKey | FEAMNHISNWMBOV-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=C3C=CC=CC3=CC4=CC=CC=C42 |
Computed by PubChem (NCBI)