CAS 198275-79-5 appears in our catalog under these names: N-Phenyl-3-biphenylamine, 95%, N-Phenyl-(1,1'-biphenyl)-3-amine, 95-<97%, N–Phenyl–3–biphenylamine, N-Phenyl-3-biphenylamine, >98.0%(GC), N-Phenyl-3-biphenylamine, 99%, 99%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g, 100mg.
N,3-diphenylaniline (CAS 198275-79-5) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: N,3-diphenylaniline. InChIKey: QJAYWJUCAONYLG-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | N,3-diphenylaniline |
| InChIKey | QJAYWJUCAONYLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)