CAS 98343-26-1 is the registry number for [1,1':4',1''-Terphenyl]-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-phenylphenyl)aniline (CAS 98343-26-1) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 3-(4-phenylphenyl)aniline. InChIKey: GLKYGIGRTZJUDH-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 3-(4-phenylphenyl)aniline |
| InChIKey | GLKYGIGRTZJUDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)