CAS 3678-72-6 appears in our catalog under these names: 4-Diphenylmethylpyridine, 95%, DIPHENYL-4-PYRIDYLMETHANE, 99%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 10g.
4-benzhydrylpyridine (CAS 3678-72-6) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 4-benzhydrylpyridine. InChIKey: ZWLWOTHDIGRTNE-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 4-benzhydrylpyridine |
| InChIKey | ZWLWOTHDIGRTNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)