CAS 87741-93-3 is the registry number for 2-(3-Hydroxyl)phenylquinoline, 90%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
3-quinolin-2-ylphenol (CAS 87741-93-3) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 3-quinolin-2-ylphenol. InChIKey: RUOWBAQAYCVXOA-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 3-quinolin-2-ylphenol |
| InChIKey | RUOWBAQAYCVXOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)