CAS 877868-60-5 is the registry number for 2-Chloro-5-(phenylsulfonyl)pyridine. Offered by: TRC. Available pack sizes: 250mg.
5-(benzenesulfonyl)-2-chloropyridine (CAS 877868-60-5) is a chemical compound with the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. IUPAC name: 5-(benzenesulfonyl)-2-chloropyridine. InChIKey: VLBYFPORMIPFHE-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2S |
|---|---|
| Molecular weight | 253.71 g/mol |
| IUPAC name | 5-(benzenesulfonyl)-2-chloropyridine |
| InChIKey | VLBYFPORMIPFHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)