CAS 877964-41-5 appears in our catalog under these names: 1-(2-Chloroacetyl)piperidine-3-carboxamide, 95%, 1-(2-Chloroacetyl)piperidine-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(2-chloroacetyl)piperidine-3-carboxamide (CAS 877964-41-5) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 1-(2-chloroacetyl)piperidine-3-carboxamide. InChIKey: BIXIPUBTNRBWMM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 1-(2-chloroacetyl)piperidine-3-carboxamide |
| InChIKey | BIXIPUBTNRBWMM-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)CCl)C(=O)N |
Computed by PubChem (NCBI)