Products 87802-11-7
CAS 87802-11-7 appears in our catalog under these names: 5-Chloroindole-2-carboxylic acid methyl, ester, 5 g, 5-Chloroindole-2-carboxylic acid methyl, ester, 10 g, 5-Chloroindole-2-carboxylic acid methyl, ester, 25 g, 5-Chloroindole-2-carboxylic acid methyl, ester, 50 g, Methyl 5-chloro-1H-indole-2-carboxylate, 98%. Offered by: Roth, Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 250mg, 1g, 100g.
Methyl 5-chloro-1H-indole-2-carboxylate (CAS 87802-11-7) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: methyl 5-chloro-1H-indole-2-carboxylate. InChIKey: WGAOEHZSJWVLBY-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | methyl 5-chloro-1H-indole-2-carboxylate |
| InChIKey | WGAOEHZSJWVLBY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)