CAS 87927-05-7 is the registry number for 8-Methoxy-2,5-dimethylquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-methoxy-2,5-dimethylquinoline (CAS 87927-05-7) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 8-methoxy-2,5-dimethylquinoline. InChIKey: QMLXKKFVQPSLHA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 8-methoxy-2,5-dimethylquinoline |
| InChIKey | QMLXKKFVQPSLHA-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=NC2=C(C=C1)OC)C |
Computed by PubChem (NCBI)