Products 879559-97-4
CAS 879559-97-4 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(6-methoxy-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 879559-97-4) is a chemical compound with the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. IUPAC name: (2S)-3-(6-methoxy-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FSYUBWLROZZQIE-JTQLQIEISA-N.
| Molecular formula | C14H20N2O5 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | (2S)-3-(6-methoxy-3-pyridinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FSYUBWLROZZQIE-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)