CAS 879624-32-5 appears in our catalog under these names: 2-methyl-5-(propan-2-yl)-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one, 98%, 2-Methyl-5-(propan-2-yl)-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 100mg.
2-methyl-5-propan-2-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 879624-32-5) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 2-methyl-5-propan-2-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: ZRLXWRPBRRVUPP-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 2-methyl-5-propan-2-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | ZRLXWRPBRRVUPP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=CC(=O)N2N1)C(C)C |
Computed by PubChem (NCBI)