CAS 88085-84-1 is the registry number for 6-Methoxy-2,3-dihydro-1H-indene-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-methoxy-2,3-dihydro-1H-indene-5-sulfonamide (CAS 88085-84-1) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 6-methoxy-2,3-dihydro-1H-indene-5-sulfonamide. InChIKey: IJTQKOILOUDRJL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 6-methoxy-2,3-dihydro-1H-indene-5-sulfonamide |
| InChIKey | IJTQKOILOUDRJL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCCC2=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)