CAS 88135-26-6 appears in our catalog under these names: Methyl 2-(4-amino-2,6-dichlorophenyl)acetate, 95%, Methyl 2-(4-amino-2,6-dichlorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(4-amino-2,6-dichlorophenyl)acetate (CAS 88135-26-6) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: methyl 2-(4-amino-2,6-dichlorophenyl)acetate. InChIKey: CGTBRJDCBUVUBG-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | methyl 2-(4-amino-2,6-dichlorophenyl)acetate |
| InChIKey | CGTBRJDCBUVUBG-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1Cl)N)Cl |
Computed by PubChem (NCBI)