CAS 881409-53-6 appears in our catalog under these names: 5-(2,2,2-Trifluoroethoxy)pyridine-2-carboxylic acid, 95%, 5-(2,2,2-Trifluoroethoxy)picolinic acid, 95+%, 5-(2,2,2-Trifluoroethoxy)pyridine-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 881409-53-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: KZTXIOLPGIKSOJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | KZTXIOLPGIKSOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)