CAS 881658-92-0 appears in our catalog under these names: 8-Bromo-2-methoxy-1,5-naphthyridine, 97%, 8-Bromo-2-methoxy-1,5-naphthyridine, 8-Bromo-2-methoxy-1,5-naphthyridine 97%, 8-Bromo-2-methoxy-1,5-naphthyridine, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 50g.
8-bromo-2-methoxy-1,5-naphthyridine (CAS 881658-92-0) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 8-bromo-2-methoxy-1,5-naphthyridine. InChIKey: HPQMRRPAOIGXFW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 8-bromo-2-methoxy-1,5-naphthyridine |
| InChIKey | HPQMRRPAOIGXFW-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=CN=C2C=C1)Br |
Computed by PubChem (NCBI)