Products 88167-50-4
CAS 88167-50-4 appears in our catalog under these names: 2-Amino-5-(2-bromoacetyl)benzonitrile, 98%, 2-Amino-5-(2-bromoacetyl)benzonitrile hydrobromide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5000mg, 1000mg.
2-amino-5-(2-bromoacetyl)benzonitrile (CAS 88167-50-4) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 2-amino-5-(2-bromoacetyl)benzonitrile. InChIKey: UJEZJLWSDUCAEA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 2-amino-5-(2-bromoacetyl)benzonitrile |
| InChIKey | UJEZJLWSDUCAEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)C#N)N |
Computed by PubChem (NCBI)