CAS 881995-69-3 appears in our catalog under these names: (R)-Methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate, 97%, 97%, Sitagliptin Impurity 57. Offered by: Chemat, Chemat Brand. Available pack sizes: 50mg, 100mg, 250mg, 1g, on request.
Methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS 881995-69-3) is a chemical compound with the molecular formula C11H12F3NO2 and a molecular weight of 247.21 g/mol. IUPAC name: methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate. InChIKey: AWFWTEYDIPQVSG-SSDOTTSWSA-N.
| Molecular formula | C11H12F3NO2 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate |
| InChIKey | AWFWTEYDIPQVSG-SSDOTTSWSA-N |
| SMILES | COC(=O)C[C@@H](CC1=CC(=C(C=C1F)F)F)N |
Computed by PubChem (NCBI)