CAS 882610-77-7 appears in our catalog under these names: N-(5-Methyl-1,2-oxazol-3-yl)-3-oxobutanamide, 95%, N-(5-Methyl-1,2-oxazol-3-yl)-3-oxobutanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-(5-methyl-1,2-oxazol-3-yl)-3-oxobutanamide (CAS 882610-77-7) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: N-(5-methyl-1,2-oxazol-3-yl)-3-oxobutanamide. InChIKey: LHSSBYKOOGOGOY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | N-(5-methyl-1,2-oxazol-3-yl)-3-oxobutanamide |
| InChIKey | LHSSBYKOOGOGOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)CC(=O)C |
Computed by PubChem (NCBI)