CAS 883-18-1 appears in our catalog under these names: 1-Methyl-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid, 98%, 1-Methyl-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 100mg.
1-methyl-4-oxocinnoline-3-carboxylic acid (CAS 883-18-1) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 1-methyl-4-oxocinnoline-3-carboxylic acid. InChIKey: MRKGRJJAAGFLFT-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1-methyl-4-oxocinnoline-3-carboxylic acid |
| InChIKey | MRKGRJJAAGFLFT-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)C(=N1)C(=O)O |
Computed by PubChem (NCBI)