Products 88312-54-3
CAS 88312-54-3 is the registry number for Antibacterial agent 188. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (CAS 88312-54-3) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: 3-amino-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione. InChIKey: PUSDFVLFQCPXAL-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 3-amino-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | PUSDFVLFQCPXAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=NNC3=S)N |
Computed by PubChem (NCBI)