CAS 884340-91-4 appears in our catalog under these names: 4–Chloro–5,7–dimethoxyquinazoline, 4-Chloro-5,7-dimethoxyquinazoline, 95%, 4-Chloro-5,7-dimethoxyquinazoline 97%, 4-Chloro-5,7-dimethoxyquinazoline, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-chloro-5,7-dimethoxyquinazoline (CAS 884340-91-4) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 4-chloro-5,7-dimethoxyquinazoline. InChIKey: BTGIKZVZNHHDAU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-chloro-5,7-dimethoxyquinazoline |
| InChIKey | BTGIKZVZNHHDAU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=NC=N2)Cl |
Computed by PubChem (NCBI)