Products 885271-24-9
CAS 885271-24-9 is the registry number for 6-Bromo-8-methoxy-2h-chromene-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
6-bromo-8-methoxy-2H-chromene-3-carbonitrile (CAS 885271-24-9) is a chemical compound with the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. IUPAC name: 6-bromo-8-methoxy-2H-chromene-3-carbonitrile. InChIKey: DEZLOCCCPMXTEQ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO2 |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 6-bromo-8-methoxy-2H-chromene-3-carbonitrile |
| InChIKey | DEZLOCCCPMXTEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OCC(=C2)C#N)Br |
Computed by PubChem (NCBI)