CAS 885271-54-5 is the registry number for Ethyl 5-chloroimidazo[1,5-a]pyridine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 5-chloroimidazo[1,5-a]pyridine-1-carboxylate (CAS 885271-54-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 5-chloroimidazo[1,5-a]pyridine-1-carboxylate. InChIKey: NKMJBGUAWJPRBV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 5-chloroimidazo[1,5-a]pyridine-1-carboxylate |
| InChIKey | NKMJBGUAWJPRBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=CC=C(N2C=N1)Cl |
Computed by PubChem (NCBI)