Products 885461-14-3
CAS 885461-14-3 appears in our catalog under these names: 4,6-Dimethylthieno(2,3-b)pyridine-2-carboxylic acid, 4,6-Dimethylthieno[2,3-b]pyridine-2-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid (CAS 885461-14-3) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: OKPHGWXJQSOYAX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 4,6-dimethylthieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | OKPHGWXJQSOYAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)