Products 885466-70-6
CAS 885466-70-6 is the registry number for ZH8659. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(furan-2-yl)phenyl]ethanamine (CAS 885466-70-6) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2-[4-(furan-2-yl)phenyl]ethanamine. InChIKey: FZMXPPREHPXEPG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-[4-(furan-2-yl)phenyl]ethanamine |
| InChIKey | FZMXPPREHPXEPG-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C=C2)CCN |
Computed by PubChem (NCBI)
Synonyms:
orb1944029, 2-[4-(furan-2-yl)phenyl]ethan-1-amine