CAS 885518-94-5 appears in our catalog under these names: 5-Hydroxy-1H-indazole-3-carboxylic acid, 5-Hydroxy-1H-indazole-3-carboxylic acid, 95%, 95%, 5-Hydroxy-1H-indazole-3-carboxylic acid, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg.
5-hydroxy-1H-indazole-3-carboxylic acid (CAS 885518-94-5) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-hydroxy-1H-indazole-3-carboxylic acid. InChIKey: FAWRWXHECPLDFD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-hydroxy-1H-indazole-3-carboxylic acid |
| InChIKey | FAWRWXHECPLDFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)