CAS 885951-98-4 appears in our catalog under these names: 2-Ethynyl-4-nitrophenol, 95%, 2-Ethynyl-4-nitrophenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-ethynyl-4-nitrophenol (CAS 885951-98-4) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 2-ethynyl-4-nitrophenol. InChIKey: UIGDPJSERRIBOZ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-ethynyl-4-nitrophenol |
| InChIKey | UIGDPJSERRIBOZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)