Products 886361-59-7
CAS 886361-59-7 is the registry number for 2-Chloro-4,6-dimethyl-3-(methylsulfonyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-4,6-dimethyl-3-methylsulfonylpyridine (CAS 886361-59-7) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: 2-chloro-4,6-dimethyl-3-methylsulfonylpyridine. InChIKey: HIVSOHMOBXFRDF-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | 2-chloro-4,6-dimethyl-3-methylsulfonylpyridine |
| InChIKey | HIVSOHMOBXFRDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1S(=O)(=O)C)Cl)C |
Computed by PubChem (NCBI)