CAS 886366-10-5 appears in our catalog under these names: 1-(2-Methylphenyl)cyclopropanecarboxylic Acid, 1-(2-Methylphenyl)cyclopropanecarboxylic acid 95%, 1-(2-Methylphenyl)cyclopropanecarboxylic acid, 95%, 95%, 1-(2-Methylphenyl)cyclopropanecarboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1-(2-methylphenyl)cyclopropane-1-carboxylic acid (CAS 886366-10-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(2-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: MNCZBOKUHKAUHT-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(2-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | MNCZBOKUHKAUHT-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2(CC2)C(=O)O |
Computed by PubChem (NCBI)