CAS 886366-16-1 appears in our catalog under these names: 1-(3-methylphenyl)cyclopropane-1-carboxylic acid, 98%, 98%, 1-(3-Methylphenyl)cyclopropanecarboxylic Acid, 1-(m-Tolyl)cyclopropanecarboxylic acid 95%, 1-(m-Tolyl)cyclopropanecarboxylic acid, 98%. Offered by: Chemat, TRC, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 5g, 2,5g, 250mg, 1g, 500mg, 2.5g, 10g.
1-(3-methylphenyl)cyclopropane-1-carboxylic acid (CAS 886366-16-1) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(3-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: RUVWKLPXGCGYOR-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(3-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RUVWKLPXGCGYOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(CC2)C(=O)O |
Computed by PubChem (NCBI)