Products 886371-05-7
CAS 886371-05-7 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-2,2,2-trifluoroethanone 95+%, 1-(2,4-Difluorophenyl)-2,2,2-trifluoroethanone, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone (CAS 886371-05-7) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone. InChIKey: JMRMOPRHHLTLDG-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | JMRMOPRHHLTLDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)