CAS 886372-43-6 is the registry number for 4-(2,2,2-Trifluoroethoxy)picolinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 886372-43-6) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: MBQHBIGLVVHFDE-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | MBQHBIGLVVHFDE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)