CAS 887571-40-6 appears in our catalog under these names: 5-Bromo-1-methyl-1H-1,3-benzodiazole-2-carbaldehyde, 95%, 5-Bromo-1-methyl-1H-1,3-benzodiazole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-1-methylbenzimidazole-2-carbaldehyde (CAS 887571-40-6) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromo-1-methylbenzimidazole-2-carbaldehyde. InChIKey: ZAJSAYQLLBKWQQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromo-1-methylbenzimidazole-2-carbaldehyde |
| InChIKey | ZAJSAYQLLBKWQQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)N=C1C=O |
Computed by PubChem (NCBI)