CAS 88790-90-3 appears in our catalog under these names: Methyl 3-aminonaphthalene-1-carboxylate, Methyl 3-amino-1-naphthoate, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 10g, 5g, 1g.
Methyl 3-aminonaphthalene-1-carboxylate (CAS 88790-90-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 3-aminonaphthalene-1-carboxylate. InChIKey: SXKPYDRBFCWMNT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 3-aminonaphthalene-1-carboxylate |
| InChIKey | SXKPYDRBFCWMNT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC2=CC=CC=C21)N |
Computed by PubChem (NCBI)