CAS 889858-16-6 appears in our catalog under these names: tert-Butyl 6-formylpicolinate, 95%, 95%, 1,1-Dimethylethyl 6-formyl-2-pyridinecarboxylate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-formylpyridine-2-carboxylate (CAS 889858-16-6) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: tert-butyl 6-formylpyridine-2-carboxylate. InChIKey: JXQRPRAHBJCZHI-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | tert-butyl 6-formylpyridine-2-carboxylate |
| InChIKey | JXQRPRAHBJCZHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=N1)C=O |
Computed by PubChem (NCBI)