CAS 889944-45-0 appears in our catalog under these names: (6-Nitroquinolin-2-yl)methanol, 95%, (6-Nitroquinolin-2-yl)methanol, 97%, (6–Nitroquinolin–2–yl)methanol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(6-nitroquinolin-2-yl)methanol (CAS 889944-45-0) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: (6-nitroquinolin-2-yl)methanol. InChIKey: JDYYLMAWYVNLPY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | (6-nitroquinolin-2-yl)methanol |
| InChIKey | JDYYLMAWYVNLPY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)CO)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)