CAS 889947-05-1 is the registry number for 3HKT-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid (CAS 889947-05-1) is a chemical compound with the molecular formula C12H11BrN2O3 and a molecular weight of 311.13 g/mol. IUPAC name: 4-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid. InChIKey: CEILSLWYFCDNGC-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O3 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | 4-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid |
| InChIKey | CEILSLWYFCDNGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCCC(=O)O)Br |
Computed by PubChem (NCBI)