CAS 890079-77-3 appears in our catalog under these names: 3-Bromo-2-methoxy-9H-carbazole 95%, 3-Bromo-2-methoxy-9H-carbazole, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
3-bromo-2-methoxy-9H-carbazole (CAS 890079-77-3) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: 3-bromo-2-methoxy-9H-carbazole. InChIKey: AUUPCPGATXHUTA-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 3-bromo-2-methoxy-9H-carbazole |
| InChIKey | AUUPCPGATXHUTA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C3=CC=CC=C3NC2=C1)Br |
Computed by PubChem (NCBI)