Products 89047-45-0
CAS 89047-45-0 appears in our catalog under these names: Quinoline-2-carboxylic acid hydrochloride, 95%+, 95%+, Quinoline-2-carboxylic acid hydrochloride, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Quinoline-2-carboxylic acid;hydrochloride (CAS 89047-45-0) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: quinoline-2-carboxylic acid;hydrochloride. InChIKey: DASZTFGYDXJWBT-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | quinoline-2-carboxylic acid;hydrochloride |
| InChIKey | DASZTFGYDXJWBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)